C11H7F2N3O3S — CID 121006074
3,5-difluoro-N-(4-methyl-1,3-thiazol-2-yl)-2-nitrobenzamide (PubChem CID 121006074) has the molecular formula C11H7F2N3O3S and a molecular weight of 299.26 g/mol. Its IUPAC name is 3,5-difluoro-N-(4-methyl-1,3-thiazol-2-yl)-2-nitrobenzamide.
| Compound Name | 3,5-difluoro-N-(4-methyl-1,3-thiazol-2-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 121006074 |
| Molecular Formula | C11H7F2N3O3S |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 3,5-difluoro-N-(4-methyl-1,3-thiazol-2-yl)-2-nitrobenzamide |
| SMILES | Cc1csc(NC(=O)c2cc(F)cc(F)c2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C11H7F2N3O3S/c1-5-4-20-11(14-5)15-10(17)7-2-6(12)3-8(13)9(7)16(18)19/h2-4H,1H3,(H,14,15,17) |
| InChIKey | OHGUROBLEIRBIU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|