C11H9ClN2O2S — CID 102523467
N-(4-chloro-1,3-thiazol-2-yl)-2-hydroxy-5-methylbenzamide (PubChem CID 102523467) has the molecular formula C11H9ClN2O2S and a molecular weight of 268.72 g/mol. Its IUPAC name is N-(4-chloro-1,3-thiazol-2-yl)-2-hydroxy-5-methylbenzamide.
| Compound Name | N-(4-chloro-1,3-thiazol-2-yl)-2-hydroxy-5-methylbenzamide |
|---|---|
| PubChem CID | 102523467 |
| Molecular Formula | C11H9ClN2O2S |
| Molecular Weight | 268.72 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | N-(4-chloro-1,3-thiazol-2-yl)-2-hydroxy-5-methylbenzamide |
| SMILES | Cc1ccc(O)c(C(=O)Nc2nc(Cl)cs2)c1 |
| InChI | InChI=1S/C11H9ClN2O2S/c1-6-2-3-8(15)7(4-6)10(16)14-11-13-9(12)5-17-11/h2-5,15H,1H3,(H,13,14,16) |
| InChIKey | NSMMIWHAZICVQM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.72 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |