C13H13ClN2O2S — CID 18129996
5-chloro-2-hydroxy-N-(4-propan-2-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 18129996) has the molecular formula C13H13ClN2O2S and a molecular weight of 296.78 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-N-(4-propan-2-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 5-chloro-2-hydroxy-N-(4-propan-2-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 18129996 |
| Molecular Formula | C13H13ClN2O2S |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 5-chloro-2-hydroxy-N-(4-propan-2-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | CC(C)c1csc(NC(=O)c2cc(Cl)ccc2O)n1 |
| InChI | InChI=1S/C13H13ClN2O2S/c1-7(2)10-6-19-13(15-10)16-12(18)9-5-8(14)3-4-11(9)17/h3-7,17H,1-2H3,(H,15,16,18) |
| InChIKey | JJEAQSZYQJEENW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |