C13H13ClN2OS2 — CID 107025323
2-chloro-N-(4-propan-2-yl-1,3-thiazol-2-yl)-5-sulfanylbenzamide (PubChem CID 107025323) has the molecular formula C13H13ClN2OS2 and a molecular weight of 312.85 g/mol. Its IUPAC name is 2-chloro-N-(4-propan-2-yl-1,3-thiazol-2-yl)-5-sulfanylbenzamide.
| Compound Name | 2-chloro-N-(4-propan-2-yl-1,3-thiazol-2-yl)-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107025323 |
| Molecular Formula | C13H13ClN2OS2 |
| Molecular Weight | 312.85 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 2-chloro-N-(4-propan-2-yl-1,3-thiazol-2-yl)-5-sulfanylbenzamide |
| SMILES | CC(C)c1csc(NC(=O)c2cc(S)ccc2Cl)n1 |
| InChI | InChI=1S/C13H13ClN2OS2/c1-7(2)11-6-19-13(15-11)16-12(17)9-5-8(18)3-4-10(9)14/h3-7,18H,1-2H3,(H,15,16,17) |
| InChIKey | IQMOMZYTUSAAOF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.85 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|