C11H9ClN2OS2 — CID 107021003
2-chloro-N-(5-methyl-1,3-thiazol-2-yl)-5-sulfanylbenzamide (PubChem CID 107021003) has the molecular formula C11H9ClN2OS2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 2-chloro-N-(5-methyl-1,3-thiazol-2-yl)-5-sulfanylbenzamide.
| Compound Name | 2-chloro-N-(5-methyl-1,3-thiazol-2-yl)-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107021003 |
| Molecular Formula | C11H9ClN2OS2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 2-chloro-N-(5-methyl-1,3-thiazol-2-yl)-5-sulfanylbenzamide |
| SMILES | Cc1cnc(NC(=O)c2cc(S)ccc2Cl)s1 |
| InChI | InChI=1S/C11H9ClN2OS2/c1-6-5-13-11(17-6)14-10(15)8-4-7(16)2-3-9(8)12/h2-5,16H,1H3,(H,13,14,15) |
| InChIKey | MPDRLCKIEFXCEW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|