C13H15N3OS — CID 102704840
5-amino-2,4-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 102704840) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 5-amino-2,4-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 5-amino-2,4-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 102704840 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 5-amino-2,4-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1cnc(NC(=O)c2cc(N)c(C)cc2C)s1 |
| InChI | InChI=1S/C13H15N3OS/c1-7-4-8(2)11(14)5-10(7)12(17)16-13-15-6-9(3)18-13/h4-6H,14H2,1-3H3,(H,15,16,17) |
| InChIKey | JGPCEQAJRFRGTE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|