About 5-amino-2,4-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)benzamide
5-amino-2,4-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 102704840) has the molecular formula C13H15N3OS
and a molecular weight of 261.35 g/mol. Its IUPAC name is 5-amino-2,4-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 5-amino-2,4-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
| PubChem CID | 102704840 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 5-amino-2,4-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | Cc1cnc(NC(=O)c2cc(N)c(C)cc2C)s1 |
| InChI | InChI=1S/C13H15N3OS/c1-7-4-8(2)11(14)5-10(7)12(17)16-13-15-6-9(3)18-13/h4-6H,14H2,1-3H3,(H,15,16,17) |
| InChIKey | JGPCEQAJRFRGTE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2,4-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2,4-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)benzamide?
The IUPAC name of 5-amino-2,4-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)benzamide (CID 102704840) is 5-amino-2,4-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 5-amino-2,4-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 5-amino-2,4-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)benzamide is Cc1cnc(NC(=O)c2cc(N)c(C)cc2C)s1.
What is the InChIKey of 5-amino-2,4-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)benzamide?
The InChIKey is JGPCEQAJRFRGTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3OS/c1-7-4-8(2)11(14)5-10(7)12(17)16-13-15-6-9(3)18-13/h4-6H,14H2,1-3H3,(H,15,16,17).
What are the key properties of 5-amino-2,4-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)benzamide?
5-amino-2,4-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)benzamide has a molecular weight of 261.35 g/mol, XLogP of 2.90, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2,4-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 102704840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).