C10H8BrN3OS — CID 66463454
6-bromo-N-(5-methyl-1,3-thiazol-2-yl)pyridine-3-carboxamide (PubChem CID 66463454) has the molecular formula C10H8BrN3OS and a molecular weight of 298.17 g/mol. Its IUPAC name is 6-bromo-N-(5-methyl-1,3-thiazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 6-bromo-N-(5-methyl-1,3-thiazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66463454 |
| Molecular Formula | C10H8BrN3OS |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | 6-bromo-N-(5-methyl-1,3-thiazol-2-yl)pyridine-3-carboxamide |
| SMILES | Cc1cnc(NC(=O)c2ccc(Br)nc2)s1 |
| InChI | InChI=1S/C10H8BrN3OS/c1-6-4-13-10(16-6)14-9(15)7-2-3-8(11)12-5-7/h2-5H,1H3,(H,13,14,15) |
| InChIKey | QENDOYXNCHBTOJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|