C9H5Br2N3OS — CID 66462491
6-bromo-N-(5-bromo-1,3-thiazol-2-yl)pyridine-3-carboxamide (PubChem CID 66462491) has the molecular formula C9H5Br2N3OS and a molecular weight of 363.03 g/mol. Its IUPAC name is 6-bromo-N-(5-bromo-1,3-thiazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 6-bromo-N-(5-bromo-1,3-thiazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66462491 |
| Molecular Formula | C9H5Br2N3OS |
| Molecular Weight | 363.03 g/mol |
| Exact Mass | 360.85 |
| IUPAC Name | 6-bromo-N-(5-bromo-1,3-thiazol-2-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ncc(Br)s1)c1ccc(Br)nc1 |
| InChI | InChI=1S/C9H5Br2N3OS/c10-6-2-1-5(3-12-6)8(15)14-9-13-4-7(11)16-9/h1-4H,(H,13,14,15) |
| InChIKey | LKEKIXRCQTUZEX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.03 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|