C12H8BrN3OS — CID 63749143
N-(5-bromo-1,3-thiazol-2-yl)-1H-indole-6-carboxamide (PubChem CID 63749143) has the molecular formula C12H8BrN3OS and a molecular weight of 322.19 g/mol. Its IUPAC name is N-(5-bromo-1,3-thiazol-2-yl)-1H-indole-6-carboxamide.
| Compound Name | N-(5-bromo-1,3-thiazol-2-yl)-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 63749143 |
| Molecular Formula | C12H8BrN3OS |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | N-(5-bromo-1,3-thiazol-2-yl)-1H-indole-6-carboxamide |
| SMILES | O=C(Nc1ncc(Br)s1)c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C12H8BrN3OS/c13-10-6-15-12(18-10)16-11(17)8-2-1-7-3-4-14-9(7)5-8/h1-6,14H,(H,15,16,17) |
| InChIKey | RVKYTNGPHIYPMH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |