C15H11N3O2S — CID 63747748
N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-1H-indole-5-carboxamide (PubChem CID 63747748) has the molecular formula C15H11N3O2S and a molecular weight of 297.34 g/mol. Its IUPAC name is N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-1H-indole-5-carboxamide.
| Compound Name | N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 63747748 |
| Molecular Formula | C15H11N3O2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-1H-indole-5-carboxamide |
| SMILES | O=C(Nc1ncc(C#CCO)s1)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C15H11N3O2S/c19-7-1-2-12-9-17-15(21-12)18-14(20)11-3-4-13-10(8-11)5-6-16-13/h3-6,8-9,16,19H,7H2,(H,17,18,20) |
| InChIKey | GHHZSVJFHGKEHX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|