C14H11ClN2O3S — CID 60804564
3-chloro-4-hydroxy-N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 60804564) has the molecular formula C14H11ClN2O3S and a molecular weight of 322.77 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 60804564 |
| Molecular Formula | C14H11ClN2O3S |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1ncc(C#CCCO)s1)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C14H11ClN2O3S/c15-11-7-9(4-5-12(11)19)13(20)17-14-16-8-10(21-14)3-1-2-6-18/h4-5,7-8,18-19H,2,6H2,(H,16,17,20) |
| InChIKey | ZSODAFMDGVAKFL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|