C13H10FN3O2S — CID 104639390
5-fluoro-N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]pyridine-2-carboxamide (PubChem CID 104639390) has the molecular formula C13H10FN3O2S and a molecular weight of 291.31 g/mol. Its IUPAC name is 5-fluoro-N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]pyridine-2-carboxamide.
| Compound Name | 5-fluoro-N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 104639390 |
| Molecular Formula | C13H10FN3O2S |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 5-fluoro-N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ncc(C#CCCO)s1)c1ccc(F)cn1 |
| InChI | InChI=1S/C13H10FN3O2S/c14-9-4-5-11(15-7-9)12(19)17-13-16-8-10(20-13)3-1-2-6-18/h4-5,7-8,18H,2,6H2,(H,16,17,19) |
| InChIKey | LHJHULSROCWKKE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|