C14H12FN3O2S — CID 61029014
1-(3-fluorophenyl)-3-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]urea (PubChem CID 61029014) has the molecular formula C14H12FN3O2S and a molecular weight of 305.33 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1-(3-fluorophenyl)-3-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 61029014 |
| Molecular Formula | C14H12FN3O2S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 1-(3-fluorophenyl)-3-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]urea |
| SMILES | O=C(Nc1cccc(F)c1)Nc1ncc(C#CCCO)s1 |
| InChI | InChI=1S/C14H12FN3O2S/c15-10-4-3-5-11(8-10)17-13(20)18-14-16-9-12(21-14)6-1-2-7-19/h3-5,8-9,19H,2,7H2,(H2,16,17,18,20) |
| InChIKey | VVDPPSYYDRFCKI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|