C12H10N2O2S2 — CID 60803344
N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]thiophene-3-carboxamide (PubChem CID 60803344) has the molecular formula C12H10N2O2S2 and a molecular weight of 278.36 g/mol. Its IUPAC name is N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]thiophene-3-carboxamide.
| Compound Name | N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 60803344 |
| Molecular Formula | C12H10N2O2S2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]thiophene-3-carboxamide |
| SMILES | O=C(Nc1ncc(C#CCCO)s1)c1ccsc1 |
| InChI | InChI=1S/C12H10N2O2S2/c15-5-2-1-3-10-7-13-12(18-10)14-11(16)9-4-6-17-8-9/h4,6-8,15H,2,5H2,(H,13,14,16) |
| InChIKey | LSELQUMJJSNPMW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|