C13H10N2O4S — CID 60802471
N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]-6-oxopyran-3-carboxamide (PubChem CID 60802471) has the molecular formula C13H10N2O4S and a molecular weight of 290.30 g/mol. Its IUPAC name is N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]-6-oxopyran-3-carboxamide.
| Compound Name | N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]-6-oxopyran-3-carboxamide |
|---|---|
| PubChem CID | 60802471 |
| Molecular Formula | C13H10N2O4S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]-6-oxopyran-3-carboxamide |
| SMILES | O=C(Nc1ncc(C#CCCO)s1)c1ccc(=O)oc1 |
| InChI | InChI=1S/C13H10N2O4S/c16-6-2-1-3-10-7-14-13(20-10)15-12(18)9-4-5-11(17)19-8-9/h4-5,7-8,16H,2,6H2,(H,14,15,18) |
| InChIKey | GZLQDSXARKUFOQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|