C13H8F2N2O2S — CID 60799964
2,6-difluoro-N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 60799964) has the molecular formula C13H8F2N2O2S and a molecular weight of 294.28 g/mol. Its IUPAC name is 2,6-difluoro-N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2,6-difluoro-N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 60799964 |
| Molecular Formula | C13H8F2N2O2S |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 2,6-difluoro-N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1ncc(C#CCO)s1)c1c(F)cccc1F |
| InChI | InChI=1S/C13H8F2N2O2S/c14-9-4-1-5-10(15)11(9)12(19)17-13-16-7-8(20-13)3-2-6-18/h1,4-5,7,18H,6H2,(H,16,17,19) |
| InChIKey | FBXVBDUJGNTPEZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|