C13H8ClFN2O2S — CID 60801881
5-chloro-2-fluoro-N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 60801881) has the molecular formula C13H8ClFN2O2S and a molecular weight of 310.74 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 5-chloro-2-fluoro-N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 60801881 |
| Molecular Formula | C13H8ClFN2O2S |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 5-chloro-2-fluoro-N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1ncc(C#CCO)s1)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C13H8ClFN2O2S/c14-8-3-4-11(15)10(6-8)12(19)17-13-16-7-9(20-13)2-1-5-18/h3-4,6-7,18H,5H2,(H,16,17,19) |
| InChIKey | RGCUKZMXLXQOGW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|