C13H9Cl2N3O2S — CID 60803434
1-(2,5-dichlorophenyl)-3-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]urea (PubChem CID 60803434) has the molecular formula C13H9Cl2N3O2S and a molecular weight of 342.21 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 60803434 |
| Molecular Formula | C13H9Cl2N3O2S |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]urea |
| SMILES | O=C(Nc1ncc(C#CCO)s1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H9Cl2N3O2S/c14-8-3-4-10(15)11(6-8)17-12(20)18-13-16-7-9(21-13)2-1-5-19/h3-4,6-7,19H,5H2,(H2,16,17,18,20) |
| InChIKey | XWPDZYDCCBQUIG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|