C15H14N2O2S — CID 60800833
N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-2,4-dimethylbenzamide (PubChem CID 60800833) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-2,4-dimethylbenzamide.
| Compound Name | N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 60800833 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ncc(C#CCO)s2)c(C)c1 |
| InChI | InChI=1S/C15H14N2O2S/c1-10-5-6-13(11(2)8-10)14(19)17-15-16-9-12(20-15)4-3-7-18/h5-6,8-9,18H,7H2,1-2H3,(H,16,17,19) |
| InChIKey | UHIVGJBSGQAMNT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|