C14H14ClN3O2S — CID 60802989
4-chloro-1-ethyl-N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]pyrrole-2-carboxamide (PubChem CID 60802989) has the molecular formula C14H14ClN3O2S and a molecular weight of 323.81 g/mol. Its IUPAC name is 4-chloro-1-ethyl-N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]pyrrole-2-carboxamide.
| Compound Name | 4-chloro-1-ethyl-N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60802989 |
| Molecular Formula | C14H14ClN3O2S |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 4-chloro-1-ethyl-N-[5-(4-hydroxybut-1-ynyl)-1,3-thiazol-2-yl]pyrrole-2-carboxamide |
| SMILES | CCn1cc(Cl)cc1C(=O)Nc1ncc(C#CCCO)s1 |
| InChI | InChI=1S/C14H14ClN3O2S/c1-2-18-9-10(15)7-12(18)13(20)17-14-16-8-11(21-14)5-3-4-6-19/h7-9,19H,2,4,6H2,1H3,(H,16,17,20) |
| InChIKey | GYFHLEHSDLNZKL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|