C10H10ClN5OS — CID 62249389
5-chloro-6-hydrazinyl-N-(5-methyl-1,3-thiazol-2-yl)pyridine-3-carboxamide (PubChem CID 62249389) has the molecular formula C10H10ClN5OS and a molecular weight of 283.74 g/mol. Its IUPAC name is 5-chloro-6-hydrazinyl-N-(5-methyl-1,3-thiazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-hydrazinyl-N-(5-methyl-1,3-thiazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62249389 |
| Molecular Formula | C10H10ClN5OS |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 5-chloro-6-hydrazinyl-N-(5-methyl-1,3-thiazol-2-yl)pyridine-3-carboxamide |
| SMILES | Cc1cnc(NC(=O)c2cnc(NN)c(Cl)c2)s1 |
| InChI | InChI=1S/C10H10ClN5OS/c1-5-3-14-10(18-5)15-9(17)6-2-7(11)8(16-12)13-4-6/h2-4H,12H2,1H3,(H,13,16)(H,14,15,17) |
| InChIKey | BXBAWMLNIWPHNV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|