C11H11ClN2O2S — CID 103604372
5-chloro-N-(4-propan-2-yl-1,3-thiazol-2-yl)furan-2-carboxamide (PubChem CID 103604372) has the molecular formula C11H11ClN2O2S and a molecular weight of 270.74 g/mol. Its IUPAC name is 5-chloro-N-(4-propan-2-yl-1,3-thiazol-2-yl)furan-2-carboxamide.
| Compound Name | 5-chloro-N-(4-propan-2-yl-1,3-thiazol-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 103604372 |
| Molecular Formula | C11H11ClN2O2S |
| Molecular Weight | 270.74 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 5-chloro-N-(4-propan-2-yl-1,3-thiazol-2-yl)furan-2-carboxamide |
| SMILES | CC(C)c1csc(NC(=O)c2ccc(Cl)o2)n1 |
| InChI | InChI=1S/C11H11ClN2O2S/c1-6(2)7-5-17-11(13-7)14-10(15)8-3-4-9(12)16-8/h3-6H,1-2H3,(H,13,14,15) |
| InChIKey | RMVUDUHMAGCDLY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.74 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |