C17H12Cl2N2OS — CID 3401823
2-chloro-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-methylbenzamide (PubChem CID 3401823) has the molecular formula C17H12Cl2N2OS and a molecular weight of 363.27 g/mol. Its IUPAC name is 2-chloro-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-methylbenzamide.
| Compound Name | 2-chloro-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 3401823 |
| Molecular Formula | C17H12Cl2N2OS |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 2-chloro-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2nc(-c3ccc(Cl)cc3)cs2)c(Cl)c1 |
| InChI | InChI=1S/C17H12Cl2N2OS/c1-10-2-7-13(14(19)8-10)16(22)21-17-20-15(9-23-17)11-3-5-12(18)6-4-11/h2-9H,1H3,(H,20,21,22) |
| InChIKey | LZKUYQGTLOXRQD-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |