C14H16N2O3S — CID 103956653
N-(4-tert-butyl-1,3-thiazol-2-yl)-3,4-dihydroxybenzamide (PubChem CID 103956653) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-3,4-dihydroxybenzamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 103956653 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-3,4-dihydroxybenzamide |
| SMILES | CC(C)(C)c1csc(NC(=O)c2ccc(O)c(O)c2)n1 |
| InChI | InChI=1S/C14H16N2O3S/c1-14(2,3)11-7-20-13(15-11)16-12(19)8-4-5-9(17)10(18)6-8/h4-7,17-18H,1-3H3,(H,15,16,19) |
| InChIKey | GRYNUEPGXJEWJP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|