C16H16N4OS — CID 2477287
N-(4-tert-butyl-1,3-thiazol-2-yl)quinoxaline-6-carboxamide (PubChem CID 2477287) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)quinoxaline-6-carboxamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 2477287 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)quinoxaline-6-carboxamide |
| SMILES | CC(C)(C)c1csc(NC(=O)c2ccc3nccnc3c2)n1 |
| InChI | InChI=1S/C16H16N4OS/c1-16(2,3)13-9-22-15(19-13)20-14(21)10-4-5-11-12(8-10)18-7-6-17-11/h4-9H,1-3H3,(H,19,20,21) |
| InChIKey | OIUCYBOEOOSATB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |