C15H17BrN2O3S2 — CID 86875148
4-bromo-N-(4-tert-butyl-1,3-thiazol-2-yl)-3-methylsulfonylbenzamide (PubChem CID 86875148) has the molecular formula C15H17BrN2O3S2 and a molecular weight of 417.35 g/mol. Its IUPAC name is 4-bromo-N-(4-tert-butyl-1,3-thiazol-2-yl)-3-methylsulfonylbenzamide.
| Compound Name | 4-bromo-N-(4-tert-butyl-1,3-thiazol-2-yl)-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 86875148 |
| Molecular Formula | C15H17BrN2O3S2 |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 415.99 |
| IUPAC Name | 4-bromo-N-(4-tert-butyl-1,3-thiazol-2-yl)-3-methylsulfonylbenzamide |
| SMILES | CC(C)(C)c1csc(NC(=O)c2ccc(Br)c(S(C)(=O)=O)c2)n1 |
| InChI | InChI=1S/C15H17BrN2O3S2/c1-15(2,3)12-8-22-14(17-12)18-13(19)9-5-6-10(16)11(7-9)23(4,20)21/h5-8H,1-4H3,(H,17,18,19) |
| InChIKey | FTUPXNDPAOJGGG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |