C13H14ClN3OS — CID 2800686
N-(4-tert-butyl-1,3-thiazol-2-yl)-2-chloropyridine-4-carboxamide (PubChem CID 2800686) has the molecular formula C13H14ClN3OS and a molecular weight of 295.80 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-2-chloropyridine-4-carboxamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-chloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 2800686 |
| Molecular Formula | C13H14ClN3OS |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-chloropyridine-4-carboxamide |
| SMILES | CC(C)(C)c1csc(NC(=O)c2ccnc(Cl)c2)n1 |
| InChI | InChI=1S/C13H14ClN3OS/c1-13(2,3)9-7-19-12(16-9)17-11(18)8-4-5-15-10(14)6-8/h4-7H,1-3H3,(H,16,17,18) |
| InChIKey | JFEZTGLPSPSCAG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|