C12H9F3N2O3S2 — CID 78863489
4-methylsulfonyl-N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 78863489) has the molecular formula C12H9F3N2O3S2 and a molecular weight of 350.34 g/mol. Its IUPAC name is 4-methylsulfonyl-N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-methylsulfonyl-N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 78863489 |
| Molecular Formula | C12H9F3N2O3S2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 4-methylsulfonyl-N-[4-(trifluoromethyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2nc(C(F)(F)F)cs2)cc1 |
| InChI | InChI=1S/C12H9F3N2O3S2/c1-22(19,20)8-4-2-7(3-5-8)10(18)17-11-16-9(6-21-11)12(13,14)15/h2-6H,1H3,(H,16,17,18) |
| InChIKey | ZOYLIVJZGMJYBI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |