C9H10F2N2O3 — CID 105381320
N-(1,3-dihydroxypropan-2-yl)-2,3-difluoropyridine-4-carboxamide (PubChem CID 105381320) has the molecular formula C9H10F2N2O3 and a molecular weight of 232.19 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-2,3-difluoropyridine-4-carboxamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-2,3-difluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 105381320 |
| Molecular Formula | C9H10F2N2O3 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-2,3-difluoropyridine-4-carboxamide |
| SMILES | O=C(NC(CO)CO)c1ccnc(F)c1F |
| InChI | InChI=1S/C9H10F2N2O3/c10-7-6(1-2-12-8(7)11)9(16)13-5(3-14)4-15/h1-2,5,14-15H,3-4H2,(H,13,16) |
| InChIKey | MHOTXKMZCADBAK-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|