C9H8F4N2O2 — CID 107470818
N-(3,3-difluoro-2-hydroxypropyl)-2,3-difluoropyridine-4-carboxamide (PubChem CID 107470818) has the molecular formula C9H8F4N2O2 and a molecular weight of 252.17 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)-2,3-difluoropyridine-4-carboxamide.
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)-2,3-difluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 107470818 |
| Molecular Formula | C9H8F4N2O2 |
| Molecular Weight | 252.17 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)-2,3-difluoropyridine-4-carboxamide |
| SMILES | O=C(NCC(O)C(F)F)c1ccnc(F)c1F |
| InChI | InChI=1S/C9H8F4N2O2/c10-6-4(1-2-14-8(6)13)9(17)15-3-5(16)7(11)12/h1-2,5,7,16H,3H2,(H,15,17) |
| InChIKey | BLDTUPWHMJJNDO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.17 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|