C18H22N2O3S2 — CID 6503249
N-(2,4-dimethylphenyl)-4-piperidin-1-ylsulfonylthiophene-2-carboxamide (PubChem CID 6503249) has the molecular formula C18H22N2O3S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-4-piperidin-1-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-4-piperidin-1-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 6503249 |
| Molecular Formula | C18H22N2O3S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | N-(2,4-dimethylphenyl)-4-piperidin-1-ylsulfonylthiophene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(S(=O)(=O)N3CCCCC3)cs2)c(C)c1 |
| InChI | InChI=1S/C18H22N2O3S2/c1-13-6-7-16(14(2)10-13)19-18(21)17-11-15(12-24-17)25(22,23)20-8-4-3-5-9-20/h6-7,10-12H,3-5,8-9H2,1-2H3,(H,19,21) |
| InChIKey | NCMGKFSPZCDXPN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |