C16H16N2O5S2 — CID 6503300
2-[(4-pyrrolidin-1-ylsulfonylthiophene-2-carbonyl)amino]benzoic acid (PubChem CID 6503300) has the molecular formula C16H16N2O5S2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 2-[(4-pyrrolidin-1-ylsulfonylthiophene-2-carbonyl)amino]benzoic acid.
| Compound Name | 2-[(4-pyrrolidin-1-ylsulfonylthiophene-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 6503300 |
| Molecular Formula | C16H16N2O5S2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 2-[(4-pyrrolidin-1-ylsulfonylthiophene-2-carbonyl)amino]benzoic acid |
| SMILES | O=C(Nc1ccccc1C(=O)O)c1cc(S(=O)(=O)N2CCCC2)cs1 |
| InChI | InChI=1S/C16H16N2O5S2/c19-15(17-13-6-2-1-5-12(13)16(20)21)14-9-11(10-24-14)25(22,23)18-7-3-4-8-18/h1-2,5-6,9-10H,3-4,7-8H2,(H,17,19)(H,20,21) |
| InChIKey | CFSYIHNWVCVSJM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |