C19H22N2O4S — CID 43853676
N-(2,4-dimethylphenyl)-2-hydroxy-5-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 43853676) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-hydroxy-5-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-hydroxy-5-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 43853676 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-hydroxy-5-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(S(=O)(=O)N3CCCC3)ccc2O)c(C)c1 |
| InChI | InChI=1S/C19H22N2O4S/c1-13-5-7-17(14(2)11-13)20-19(23)16-12-15(6-8-18(16)22)26(24,25)21-9-3-4-10-21/h5-8,11-12,22H,3-4,9-10H2,1-2H3,(H,20,23) |
| InChIKey | UGAZSFGJEBILCQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |