C18H18BrFN2O3S — CID 26881892
2-bromo-N-(2-fluoro-5-methylphenyl)-5-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 26881892) has the molecular formula C18H18BrFN2O3S and a molecular weight of 441.32 g/mol. Its IUPAC name is 2-bromo-N-(2-fluoro-5-methylphenyl)-5-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 2-bromo-N-(2-fluoro-5-methylphenyl)-5-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 26881892 |
| Molecular Formula | C18H18BrFN2O3S |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | 2-bromo-N-(2-fluoro-5-methylphenyl)-5-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | Cc1ccc(F)c(NC(=O)c2cc(S(=O)(=O)N3CCCC3)ccc2Br)c1 |
| InChI | InChI=1S/C18H18BrFN2O3S/c1-12-4-7-16(20)17(10-12)21-18(23)14-11-13(5-6-15(14)19)26(24,25)22-8-2-3-9-22/h4-7,10-11H,2-3,8-9H2,1H3,(H,21,23) |
| InChIKey | ZLZIBRNDGLREAN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |