C22H26BrN3O3S — CID 26520197
2-bromo-N-(2-piperidin-1-ylphenyl)-5-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 26520197) has the molecular formula C22H26BrN3O3S and a molecular weight of 492.44 g/mol. Its IUPAC name is 2-bromo-N-(2-piperidin-1-ylphenyl)-5-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 2-bromo-N-(2-piperidin-1-ylphenyl)-5-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 26520197 |
| Molecular Formula | C22H26BrN3O3S |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | 2-bromo-N-(2-piperidin-1-ylphenyl)-5-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1ccccc1N1CCCCC1)c1cc(S(=O)(=O)N2CCCC2)ccc1Br |
| InChI | InChI=1S/C22H26BrN3O3S/c23-19-11-10-17(30(28,29)26-14-6-7-15-26)16-18(19)22(27)24-20-8-2-3-9-21(20)25-12-4-1-5-13-25/h2-3,8-11,16H,1,4-7,12-15H2,(H,24,27) |
| InChIKey | OBBQYMHTBPBMMM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |