C18H21BrN4O3S — CID 55647459
2-bromo-N-[2-(dimethylamino)-3-pyridinyl]-5-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 55647459) has the molecular formula C18H21BrN4O3S and a molecular weight of 453.36 g/mol. Its IUPAC name is 2-bromo-N-[2-(dimethylamino)-3-pyridinyl]-5-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 2-bromo-N-[2-(dimethylamino)-3-pyridinyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55647459 |
| Molecular Formula | C18H21BrN4O3S |
| Molecular Weight | 453.36 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 2-bromo-N-[2-(dimethylamino)-3-pyridinyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CN(C)c1ncccc1NC(=O)c1cc(S(=O)(=O)N2CCCC2)ccc1Br |
| InChI | InChI=1S/C18H21BrN4O3S/c1-22(2)17-16(6-5-9-20-17)21-18(24)14-12-13(7-8-15(14)19)27(25,26)23-10-3-4-11-23/h5-9,12H,3-4,10-11H2,1-2H3,(H,21,24) |
| InChIKey | NEQZAVSYPLLYRV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |