C24H31N3O3S — CID 29200072
N-(2,3-dimethylphenyl)-5-piperidin-1-ylsulfonyl-2-pyrrolidin-1-ylbenzamide (PubChem CID 29200072) has the molecular formula C24H31N3O3S and a molecular weight of 441.60 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-5-piperidin-1-ylsulfonyl-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-(2,3-dimethylphenyl)-5-piperidin-1-ylsulfonyl-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 29200072 |
| Molecular Formula | C24H31N3O3S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-(2,3-dimethylphenyl)-5-piperidin-1-ylsulfonyl-2-pyrrolidin-1-ylbenzamide |
| SMILES | Cc1cccc(NC(=O)c2cc(S(=O)(=O)N3CCCCC3)ccc2N2CCCC2)c1C |
| InChI | InChI=1S/C24H31N3O3S/c1-18-9-8-10-22(19(18)2)25-24(28)21-17-20(11-12-23(21)26-13-6-7-14-26)31(29,30)27-15-4-3-5-16-27/h8-12,17H,3-7,13-16H2,1-2H3,(H,25,28) |
| InChIKey | OAHYVPDTMATMGP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |