C20H21IN2O6S — CID 23931463
[2-(4-iodo-2-methylanilino)-2-oxoethyl] 2-hydroxy-5-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 23931463) has the molecular formula C20H21IN2O6S and a molecular weight of 544.37 g/mol. Its IUPAC name is [2-(4-iodo-2-methylanilino)-2-oxoethyl] 2-hydroxy-5-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(4-iodo-2-methylanilino)-2-oxoethyl] 2-hydroxy-5-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 23931463 |
| Molecular Formula | C20H21IN2O6S |
| Molecular Weight | 544.37 g/mol |
| Exact Mass | 544.02 |
| IUPAC Name | [2-(4-iodo-2-methylanilino)-2-oxoethyl] 2-hydroxy-5-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | Cc1cc(I)ccc1NC(=O)COC(=O)c1cc(S(=O)(=O)N2CCCC2)ccc1O |
| InChI | InChI=1S/C20H21IN2O6S/c1-13-10-14(21)4-6-17(13)22-19(25)12-29-20(26)16-11-15(5-7-18(16)24)30(27,28)23-8-2-3-9-23/h4-7,10-11,24H,2-3,8-9,12H2,1H3,(H,22,25) |
| InChIKey | KZVRWQUJFNALHC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|