C22H24ClN3O8S — CID 3566392
[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 3566392) has the molecular formula C22H24ClN3O8S and a molecular weight of 525.97 g/mol. Its IUPAC name is [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 3566392 |
| Molecular Formula | C22H24ClN3O8S |
| Molecular Weight | 525.97 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | COc1cc(NC(=O)COC(=O)c2cc(S(=O)(=O)N3CCCCC3)ccc2Cl)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H24ClN3O8S/c1-14-10-19(26(29)30)20(33-2)12-18(14)24-21(27)13-34-22(28)16-11-15(6-7-17(16)23)35(31,32)25-8-4-3-5-9-25/h6-7,10-12H,3-5,8-9,13H2,1-2H3,(H,24,27) |
| InChIKey | NWTSANXRJJFFQZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.97 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|