C16H18N2O5S2 — CID 6503499
N-(2-hydroxy-5-methylphenyl)-4-morpholin-4-ylsulfonylthiophene-2-carboxamide (PubChem CID 6503499) has the molecular formula C16H18N2O5S2 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-(2-hydroxy-5-methylphenyl)-4-morpholin-4-ylsulfonylthiophene-2-carboxamide.
| Compound Name | N-(2-hydroxy-5-methylphenyl)-4-morpholin-4-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 6503499 |
| Molecular Formula | C16H18N2O5S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | N-(2-hydroxy-5-methylphenyl)-4-morpholin-4-ylsulfonylthiophene-2-carboxamide |
| SMILES | Cc1ccc(O)c(NC(=O)c2cc(S(=O)(=O)N3CCOCC3)cs2)c1 |
| InChI | InChI=1S/C16H18N2O5S2/c1-11-2-3-14(19)13(8-11)17-16(20)15-9-12(10-24-15)25(21,22)18-4-6-23-7-5-18/h2-3,8-10,19H,4-7H2,1H3,(H,17,20) |
| InChIKey | BGIWNWGXWGCBQP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|