C9H12N2O4S2 — CID 6486031
4-morpholin-4-ylsulfonylthiophene-2-carboxamide (PubChem CID 6486031) has the molecular formula C9H12N2O4S2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 4-morpholin-4-ylsulfonylthiophene-2-carboxamide.
| Compound Name | 4-morpholin-4-ylsulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 6486031 |
| Molecular Formula | C9H12N2O4S2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 4-morpholin-4-ylsulfonylthiophene-2-carboxamide |
| SMILES | NC(=O)c1cc(S(=O)(=O)N2CCOCC2)cs1 |
| InChI | InChI=1S/C9H12N2O4S2/c10-9(12)8-5-7(6-16-8)17(13,14)11-1-3-15-4-2-11/h5-6H,1-4H2,(H2,10,12) |
| InChIKey | CFDIPGDYLCDIMN-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |