C16H25N3O4S2 — CID 46336000
4-[4-[methyl(oxolan-2-ylmethyl)amino]piperidin-1-yl]sulfonylthiophene-2-carboxamide (PubChem CID 46336000) has the molecular formula C16H25N3O4S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 4-[4-[methyl(oxolan-2-ylmethyl)amino]piperidin-1-yl]sulfonylthiophene-2-carboxamide.
| Compound Name | 4-[4-[methyl(oxolan-2-ylmethyl)amino]piperidin-1-yl]sulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 46336000 |
| Molecular Formula | C16H25N3O4S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 4-[4-[methyl(oxolan-2-ylmethyl)amino]piperidin-1-yl]sulfonylthiophene-2-carboxamide |
| SMILES | CN(CC1CCCO1)C1CCN(S(=O)(=O)c2csc(C(N)=O)c2)CC1 |
| InChI | InChI=1S/C16H25N3O4S2/c1-18(10-13-3-2-8-23-13)12-4-6-19(7-5-12)25(21,22)14-9-15(16(17)20)24-11-14/h9,11-13H,2-8,10H2,1H3,(H2,17,20) |
| InChIKey | AEFHZKWBNNZFKT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |