About pyridin-3-yl 4-morpholin-4-ylsulfonylthiophene-2-carboxylate
pyridin-3-yl 4-morpholin-4-ylsulfonylthiophene-2-carboxylate (PubChem CID 6503526) has the molecular formula C14H14N2O5S2
and a molecular weight of 354.41 g/mol. Its IUPAC name is pyridin-3-yl 4-morpholin-4-ylsulfonylthiophene-2-carboxylate.
Molecular Properties
| Compound Name | pyridin-3-yl 4-morpholin-4-ylsulfonylthiophene-2-carboxylate |
| PubChem CID | 6503526 |
| Molecular Formula | C14H14N2O5S2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | pyridin-3-yl 4-morpholin-4-ylsulfonylthiophene-2-carboxylate |
| SMILES | O=C(Oc1cccnc1)c1cc(S(=O)(=O)N2CCOCC2)cs1 |
| InChI | InChI=1S/C14H14N2O5S2/c17-14(21-11-2-1-3-15-9-11)13-8-12(10-22-13)23(18,19)16-4-6-20-7-5-16/h1-3,8-10H,4-7H2 |
| InChIKey | YMBZWLJVKBLXHZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze pyridin-3-yl 4-morpholin-4-ylsulfonylthiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-yl 4-morpholin-4-ylsulfonylthiophene-2-carboxylate?
The IUPAC name of pyridin-3-yl 4-morpholin-4-ylsulfonylthiophene-2-carboxylate (CID 6503526) is pyridin-3-yl 4-morpholin-4-ylsulfonylthiophene-2-carboxylate.
What is the SMILES notation for pyridin-3-yl 4-morpholin-4-ylsulfonylthiophene-2-carboxylate?
The canonical SMILES for pyridin-3-yl 4-morpholin-4-ylsulfonylthiophene-2-carboxylate is O=C(Oc1cccnc1)c1cc(S(=O)(=O)N2CCOCC2)cs1.
What is the InChIKey of pyridin-3-yl 4-morpholin-4-ylsulfonylthiophene-2-carboxylate?
The InChIKey is YMBZWLJVKBLXHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O5S2/c17-14(21-11-2-1-3-15-9-11)13-8-12(10-22-13)23(18,19)16-4-6-20-7-5-16/h1-3,8-10H,4-7H2.
What are the key properties of pyridin-3-yl 4-morpholin-4-ylsulfonylthiophene-2-carboxylate?
pyridin-3-yl 4-morpholin-4-ylsulfonylthiophene-2-carboxylate has a molecular weight of 354.41 g/mol, XLogP of 1.38, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-yl 4-morpholin-4-ylsulfonylthiophene-2-carboxylate is sourced from PubChem (CID 6503526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).