C18H19NO6S2 — CID 6503460
1,3-benzodioxol-5-yl 4-(azepan-1-ylsulfonyl)thiophene-2-carboxylate (PubChem CID 6503460) has the molecular formula C18H19NO6S2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 4-(azepan-1-ylsulfonyl)thiophene-2-carboxylate.
| Compound Name | 1,3-benzodioxol-5-yl 4-(azepan-1-ylsulfonyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 6503460 |
| Molecular Formula | C18H19NO6S2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 1,3-benzodioxol-5-yl 4-(azepan-1-ylsulfonyl)thiophene-2-carboxylate |
| SMILES | O=C(Oc1ccc2c(c1)OCO2)c1cc(S(=O)(=O)N2CCCCCC2)cs1 |
| InChI | InChI=1S/C18H19NO6S2/c20-18(25-13-5-6-15-16(9-13)24-12-23-15)17-10-14(11-26-17)27(21,22)19-7-3-1-2-4-8-19/h5-6,9-11H,1-4,7-8,12H2 |
| InChIKey | WPAXBLWGZGRXSF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|