C17H17NO6S2 — CID 43013494
1,3-benzodioxol-5-yl 1-thiophen-2-ylsulfonylpiperidine-3-carboxylate (PubChem CID 43013494) has the molecular formula C17H17NO6S2 and a molecular weight of 395.46 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 1-thiophen-2-ylsulfonylpiperidine-3-carboxylate.
| Compound Name | 1,3-benzodioxol-5-yl 1-thiophen-2-ylsulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 43013494 |
| Molecular Formula | C17H17NO6S2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 1,3-benzodioxol-5-yl 1-thiophen-2-ylsulfonylpiperidine-3-carboxylate |
| SMILES | O=C(Oc1ccc2c(c1)OCO2)C1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C17H17NO6S2/c19-17(24-13-5-6-14-15(9-13)23-11-22-14)12-3-1-7-18(10-12)26(20,21)16-4-2-8-25-16/h2,4-6,8-9,12H,1,3,7,10-11H2 |
| InChIKey | GCEWJLHKIAEWKN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|