C15H25N4O3S2+ — CID 9075254
(3R)-N-(4-methylpiperazin-4-ium-1-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 9075254) has the molecular formula C15H25N4O3S2+ and a molecular weight of 373.52 g/mol. Its IUPAC name is (3R)-N-(4-methylpiperazin-4-ium-1-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-(4-methylpiperazin-4-ium-1-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 9075254 |
| Molecular Formula | C15H25N4O3S2+ |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (3R)-N-(4-methylpiperazin-4-ium-1-yl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | C[NH+]1CCN(NC(=O)[C@@H]2CCCN(S(=O)(=O)c3cccs3)C2)CC1 |
| InChI | InChI=1S/C15H24N4O3S2/c1-17-7-9-18(10-8-17)16-15(20)13-4-2-6-19(12-13)24(21,22)14-5-3-11-23-14/h3,5,11,13H,2,4,6-10,12H2,1H3,(H,16,20)/p+1/t13-/m1/s1 |
| InChIKey | IPTYNXDYTZTCEX-CYBMUJFWSA-O |
| XLogP | -0.99 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |