C17H26FN4O3S+ — CID 9205971
(3S)-1-(4-fluorophenyl)sulfonyl-N-(4-methylpiperazin-4-ium-1-yl)piperidine-3-carboxamide (PubChem CID 9205971) has the molecular formula C17H26FN4O3S+ and a molecular weight of 385.49 g/mol. Its IUPAC name is (3S)-1-(4-fluorophenyl)sulfonyl-N-(4-methylpiperazin-4-ium-1-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(4-fluorophenyl)sulfonyl-N-(4-methylpiperazin-4-ium-1-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 9205971 |
| Molecular Formula | C17H26FN4O3S+ |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (3S)-1-(4-fluorophenyl)sulfonyl-N-(4-methylpiperazin-4-ium-1-yl)piperidine-3-carboxamide |
| SMILES | C[NH+]1CCN(NC(=O)[C@H]2CCCN(S(=O)(=O)c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C17H25FN4O3S/c1-20-9-11-21(12-10-20)19-17(23)14-3-2-8-22(13-14)26(24,25)16-6-4-15(18)5-7-16/h4-7,14H,2-3,8-13H2,1H3,(H,19,23)/p+1/t14-/m0/s1 |
| InChIKey | COQLYDIVXNHQCY-AWEZNQCLSA-O |
| XLogP | -0.91 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |