C22H23NO5S2 — CID 46523653
(7-methoxynaphthalen-2-yl) 1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxylate (PubChem CID 46523653) has the molecular formula C22H23NO5S2 and a molecular weight of 445.56 g/mol. Its IUPAC name is (7-methoxynaphthalen-2-yl) 1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxylate.
| Compound Name | (7-methoxynaphthalen-2-yl) 1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 46523653 |
| Molecular Formula | C22H23NO5S2 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | (7-methoxynaphthalen-2-yl) 1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxylate |
| SMILES | COc1ccc2ccc(OC(=O)C3CCCN(S(=O)(=O)c4ccc(C)s4)C3)cc2c1 |
| InChI | InChI=1S/C22H23NO5S2/c1-15-5-10-21(29-15)30(25,26)23-11-3-4-17(14-23)22(24)28-20-9-7-16-6-8-19(27-2)12-18(16)13-20/h5-10,12-13,17H,3-4,11,14H2,1-2H3 |
| InChIKey | XMIIVYFPHITSHW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|