C18H17ClN2O4S2 — CID 18272789
(2-chloro-4-cyanophenyl) 1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxylate (PubChem CID 18272789) has the molecular formula C18H17ClN2O4S2 and a molecular weight of 424.93 g/mol. Its IUPAC name is (2-chloro-4-cyanophenyl) 1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxylate.
| Compound Name | (2-chloro-4-cyanophenyl) 1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 18272789 |
| Molecular Formula | C18H17ClN2O4S2 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | (2-chloro-4-cyanophenyl) 1-(5-methylthiophen-2-yl)sulfonylpiperidine-3-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(C(=O)Oc3ccc(C#N)cc3Cl)C2)s1 |
| InChI | InChI=1S/C18H17ClN2O4S2/c1-12-4-7-17(26-12)27(23,24)21-8-2-3-14(11-21)18(22)25-16-6-5-13(10-20)9-15(16)19/h4-7,9,14H,2-3,8,11H2,1H3 |
| InChIKey | XPZGSNRHAKPDFT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|