C20H19ClN2O4S — CID 8928403
(2-chloro-4-cyanophenyl) 4-methyl-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 8928403) has the molecular formula C20H19ClN2O4S and a molecular weight of 418.90 g/mol. Its IUPAC name is (2-chloro-4-cyanophenyl) 4-methyl-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (2-chloro-4-cyanophenyl) 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 8928403 |
| Molecular Formula | C20H19ClN2O4S |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | (2-chloro-4-cyanophenyl) 4-methyl-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(C#N)cc2Cl)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C20H19ClN2O4S/c1-14-5-7-16(12-19(14)28(25,26)23-9-3-2-4-10-23)20(24)27-18-8-6-15(13-22)11-17(18)21/h5-8,11-12H,2-4,9-10H2,1H3 |
| InChIKey | UEFCBKXWUKQGHX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|